C15H18N2O3S — CID 96539648
(E)-3-(3-cyanophenyl)-N-[(2R)-1-ethylsulfonylpropan-2-yl]prop-2-enamide (PubChem CID 96539648) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is (E)-3-(3-cyanophenyl)-N-[(2R)-1-ethylsulfonylpropan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(3-cyanophenyl)-N-[(2R)-1-ethylsulfonylpropan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 96539648 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (E)-3-(3-cyanophenyl)-N-[(2R)-1-ethylsulfonylpropan-2-yl]prop-2-enamide |
| SMILES | CCS(=O)(=O)C[C@@H](C)NC(=O)/C=C/c1cccc(C#N)c1 |
| InChI | InChI=1S/C15H18N2O3S/c1-3-21(19,20)11-12(2)17-15(18)8-7-13-5-4-6-14(9-13)10-16/h4-9,12H,3,11H2,1-2H3,(H,17,18)/b8-7+/t12-/m1/s1 |
| InChIKey | OWYLFCUVUUKXAC-ABZNLYFFSA-N |
| XLogP | 1.51 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|