C22H19N3O3 — CID 67130625
(2S)-2-[[(E)-3-(3-cyanophenyl)prop-2-enoyl]amino]-3-(1-methylindol-3-yl)propanoic acid (PubChem CID 67130625) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is (2S)-2-[[(E)-3-(3-cyanophenyl)prop-2-enoyl]amino]-3-(1-methylindol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[[(E)-3-(3-cyanophenyl)prop-2-enoyl]amino]-3-(1-methylindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 67130625 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (2S)-2-[[(E)-3-(3-cyanophenyl)prop-2-enoyl]amino]-3-(1-methylindol-3-yl)propanoic acid |
| SMILES | Cn1cc(C[C@H](NC(=O)/C=C/c2cccc(C#N)c2)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C22H19N3O3/c1-25-14-17(18-7-2-3-8-20(18)25)12-19(22(27)28)24-21(26)10-9-15-5-4-6-16(11-15)13-23/h2-11,14,19H,12H2,1H3,(H,24,26)(H,27,28)/b10-9+/t19-/m0/s1 |
| InChIKey | IOWVASXETSRCIM-YXBWYFRISA-N |
| XLogP | 2.88 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|