C13H13FmN2O3- — CID 168915547
fermium;(2S)-3-(1-methylindol-3-yl)-2-(oxomethylamino)propanoic acid (PubChem CID 168915547) has the molecular formula C13H13FmN2O3- and a molecular weight of 502.26 g/mol. Its IUPAC name is fermium;(2S)-3-(1-methylindol-3-yl)-2-(oxomethylamino)propanoic acid.
| Compound Name | fermium;(2S)-3-(1-methylindol-3-yl)-2-(oxomethylamino)propanoic acid |
|---|---|
| PubChem CID | 168915547 |
| Molecular Formula | C13H13FmN2O3- |
| Molecular Weight | 502.26 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | fermium;(2S)-3-(1-methylindol-3-yl)-2-(oxomethylamino)propanoic acid |
| SMILES | Cn1cc(C[C@H](N[C-]=O)C(=O)O)c2ccccc21.[Fm] |
| InChI | InChI=1S/C13H13N2O3.Fm/c1-15-7-9(6-11(13(17)18)14-8-16)10-4-2-3-5-12(10)15;/h2-5,7,11H,6H2,1H3,(H,14,16)(H,17,18);/q-1;/t11-;/m0./s1 |
| InChIKey | CZDXGIZIJWVUKX-MERQFXBCSA-N |
| XLogP | 0.83 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|