C12H15ClN2O2 — CID 134497135
2-amino-3-(1-methylindol-3-yl)propanoic acid;hydrochloride (PubChem CID 134497135) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 2-amino-3-(1-methylindol-3-yl)propanoic acid;hydrochloride.
| Compound Name | 2-amino-3-(1-methylindol-3-yl)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 134497135 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-amino-3-(1-methylindol-3-yl)propanoic acid;hydrochloride |
| SMILES | Cl.Cn1cc(CC(N)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C12H14N2O2.ClH/c1-14-7-8(6-10(13)12(15)16)9-4-2-3-5-11(9)14;/h2-5,7,10H,6,13H2,1H3,(H,15,16);1H |
| InChIKey | XHHFEVHSOOFMGW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |