C16H23N3O2 — CID 146400954
2-(dimethylamino)ethyl 2-amino-3-(1-methylindol-3-yl)propanoate (PubChem CID 146400954) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-amino-3-(1-methylindol-3-yl)propanoate.
| Compound Name | 2-(dimethylamino)ethyl 2-amino-3-(1-methylindol-3-yl)propanoate |
|---|---|
| PubChem CID | 146400954 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-amino-3-(1-methylindol-3-yl)propanoate |
| SMILES | CN(C)CCOC(=O)C(N)Cc1cn(C)c2ccccc12 |
| InChI | InChI=1S/C16H23N3O2/c1-18(2)8-9-21-16(20)14(17)10-12-11-19(3)15-7-5-4-6-13(12)15/h4-7,11,14H,8-10,17H2,1-3H3 |
| InChIKey | KQUPLZPQZFJSBI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |