C38H65N3O4 — CID 177261459
6-[4-[(2R)-2-amino-3-(1-methylindol-3-yl)propanoyl]oxybutylamino]hexyl 2-hexyldecanoate (PubChem CID 177261459) has the molecular formula C38H65N3O4 and a molecular weight of 627.96 g/mol. Its IUPAC name is 6-[4-[(2R)-2-amino-3-(1-methylindol-3-yl)propanoyl]oxybutylamino]hexyl 2-hexyldecanoate.
| Compound Name | 6-[4-[(2R)-2-amino-3-(1-methylindol-3-yl)propanoyl]oxybutylamino]hexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 177261459 |
| Molecular Formula | C38H65N3O4 |
| Molecular Weight | 627.96 g/mol |
| Exact Mass | 627.50 |
| IUPAC Name | 6-[4-[(2R)-2-amino-3-(1-methylindol-3-yl)propanoyl]oxybutylamino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCNCCCCOC(=O)[C@H](N)Cc1cn(C)c2ccccc12 |
| InChI | InChI=1S/C38H65N3O4/c1-4-6-8-10-11-15-23-32(22-14-9-7-5-2)37(42)44-28-20-13-12-18-26-40-27-19-21-29-45-38(43)35(39)30-33-31-41(3)36-25-17-16-24-34(33)36/h16-17,24-25,31-32,35,40H,4-15,18-23,26-30,39H2,1-3H3/t32?,35-/m1/s1 |
| InChIKey | ZCNSPLGCRUTUTK-IJLUWNCYSA-N |
| XLogP | 8.40 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.96 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|