C26H38N2O5 — CID 163632135
butyl (2S)-3-methyl-2-[[(2R)-2-[(1-methylindol-3-yl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoyl]amino]butanoate (PubChem CID 163632135) has the molecular formula C26H38N2O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is butyl (2S)-3-methyl-2-[[(2R)-2-[(1-methylindol-3-yl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoyl]amino]butanoate.
| Compound Name | butyl (2S)-3-methyl-2-[[(2R)-2-[(1-methylindol-3-yl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoyl]amino]butanoate |
|---|---|
| PubChem CID | 163632135 |
| Molecular Formula | C26H38N2O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | butyl (2S)-3-methyl-2-[[(2R)-2-[(1-methylindol-3-yl)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoyl]amino]butanoate |
| SMILES | CCCCOC(=O)[C@@H](NC(=O)[C@@H](Cc1cn(C)c2ccccc12)C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C26H38N2O5/c1-8-9-14-32-25(31)22(17(2)3)27-23(29)20(24(30)33-26(4,5)6)15-18-16-28(7)21-13-11-10-12-19(18)21/h10-13,16-17,20,22H,8-9,14-15H2,1-7H3,(H,27,29)/t20-,22+/m1/s1 |
| InChIKey | HXBHCNRPRFISGU-IRLDBZIGSA-N |
| XLogP | 4.16 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|