C19H25N3O5 — CID 126483127
(2-methylpropan-2-yl)oxycarbonyl 2-[[(2R)-2-amino-3-(1-methylindol-3-yl)propanoyl]amino]acetate (PubChem CID 126483127) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxycarbonyl 2-[[(2R)-2-amino-3-(1-methylindol-3-yl)propanoyl]amino]acetate.
| Compound Name | (2-methylpropan-2-yl)oxycarbonyl 2-[[(2R)-2-amino-3-(1-methylindol-3-yl)propanoyl]amino]acetate |
|---|---|
| PubChem CID | 126483127 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (2-methylpropan-2-yl)oxycarbonyl 2-[[(2R)-2-amino-3-(1-methylindol-3-yl)propanoyl]amino]acetate |
| SMILES | Cn1cc(C[C@@H](N)C(=O)NCC(=O)OC(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C19H25N3O5/c1-19(2,3)27-18(25)26-16(23)10-21-17(24)14(20)9-12-11-22(4)15-8-6-5-7-13(12)15/h5-8,11,14H,9-10,20H2,1-4H3,(H,21,24)/t14-/m1/s1 |
| InChIKey | CRCLLLGRYJLFGE-CQSZACIVSA-N |
| XLogP | 1.64 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|