C18H25N3O3 — CID 58756850
methyl 5-[[(2S)-2-amino-3-(1-methylindol-3-yl)propanoyl]amino]pentanoate (PubChem CID 58756850) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is methyl 5-[[(2S)-2-amino-3-(1-methylindol-3-yl)propanoyl]amino]pentanoate.
| Compound Name | methyl 5-[[(2S)-2-amino-3-(1-methylindol-3-yl)propanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 58756850 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | methyl 5-[[(2S)-2-amino-3-(1-methylindol-3-yl)propanoyl]amino]pentanoate |
| SMILES | COC(=O)CCCCNC(=O)[C@@H](N)Cc1cn(C)c2ccccc12 |
| InChI | InChI=1S/C18H25N3O3/c1-21-12-13(14-7-3-4-8-16(14)21)11-15(19)18(23)20-10-6-5-9-17(22)24-2/h3-4,7-8,12,15H,5-6,9-11,19H2,1-2H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | MECCPIJAJXZYTI-HNNXBMFYSA-N |
| XLogP | 1.51 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|