C20H28ClN3O3 — CID 126498916
ethyl (2R)-2-[[(2S,3S)-2-(chloroamino)-3-methylpentanoyl]amino]-3-(1-methylindol-3-yl)propanoate (PubChem CID 126498916) has the molecular formula C20H28ClN3O3 and a molecular weight of 393.92 g/mol. Its IUPAC name is ethyl (2R)-2-[[(2S,3S)-2-(chloroamino)-3-methylpentanoyl]amino]-3-(1-methylindol-3-yl)propanoate.
| Compound Name | ethyl (2R)-2-[[(2S,3S)-2-(chloroamino)-3-methylpentanoyl]amino]-3-(1-methylindol-3-yl)propanoate |
|---|---|
| PubChem CID | 126498916 |
| Molecular Formula | C20H28ClN3O3 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | ethyl (2R)-2-[[(2S,3S)-2-(chloroamino)-3-methylpentanoyl]amino]-3-(1-methylindol-3-yl)propanoate |
| SMILES | CCOC(=O)[C@@H](Cc1cn(C)c2ccccc12)NC(=O)[C@@H](NCl)[C@@H](C)CC |
| InChI | InChI=1S/C20H28ClN3O3/c1-5-13(3)18(23-21)19(25)22-16(20(26)27-6-2)11-14-12-24(4)17-10-8-7-9-15(14)17/h7-10,12-13,16,18,23H,5-6,11H2,1-4H3,(H,22,25)/t13-,16+,18-/m0/s1 |
| InChIKey | DPODXRCUADKJOB-XCRHUMRWSA-N |
| XLogP | 2.93 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|