C19H26ClN3O3S — CID 126498930
ethyl (2R)-2-[[(2S)-2-(chloroamino)-4-methylsulfanylbutanoyl]amino]-3-(1-methylindol-3-yl)propanoate (PubChem CID 126498930) has the molecular formula C19H26ClN3O3S and a molecular weight of 411.96 g/mol. Its IUPAC name is ethyl (2R)-2-[[(2S)-2-(chloroamino)-4-methylsulfanylbutanoyl]amino]-3-(1-methylindol-3-yl)propanoate.
| Compound Name | ethyl (2R)-2-[[(2S)-2-(chloroamino)-4-methylsulfanylbutanoyl]amino]-3-(1-methylindol-3-yl)propanoate |
|---|---|
| PubChem CID | 126498930 |
| Molecular Formula | C19H26ClN3O3S |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | ethyl (2R)-2-[[(2S)-2-(chloroamino)-4-methylsulfanylbutanoyl]amino]-3-(1-methylindol-3-yl)propanoate |
| SMILES | CCOC(=O)[C@@H](Cc1cn(C)c2ccccc12)NC(=O)[C@H](CCSC)NCl |
| InChI | InChI=1S/C19H26ClN3O3S/c1-4-26-19(25)16(21-18(24)15(22-20)9-10-27-3)11-13-12-23(2)17-8-6-5-7-14(13)17/h5-8,12,15-16,22H,4,9-11H2,1-3H3,(H,21,24)/t15-,16+/m0/s1 |
| InChIKey | URBBTQIOYHNMTL-JKSUJKDBSA-N |
| XLogP | 2.63 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|