C19H25Cl2N3O2 — CID 126498949
2-(1-chloropiperidin-4-yl)ethyl (2R)-2-(chloroamino)-3-(1-methylindol-3-yl)propanoate (PubChem CID 126498949) has the molecular formula C19H25Cl2N3O2 and a molecular weight of 398.33 g/mol. Its IUPAC name is 2-(1-chloropiperidin-4-yl)ethyl (2R)-2-(chloroamino)-3-(1-methylindol-3-yl)propanoate.
| Compound Name | 2-(1-chloropiperidin-4-yl)ethyl (2R)-2-(chloroamino)-3-(1-methylindol-3-yl)propanoate |
|---|---|
| PubChem CID | 126498949 |
| Molecular Formula | C19H25Cl2N3O2 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-(1-chloropiperidin-4-yl)ethyl (2R)-2-(chloroamino)-3-(1-methylindol-3-yl)propanoate |
| SMILES | Cn1cc(C[C@@H](NCl)C(=O)OCCC2CCN(Cl)CC2)c2ccccc21 |
| InChI | InChI=1S/C19H25Cl2N3O2/c1-23-13-15(16-4-2-3-5-18(16)23)12-17(22-20)19(25)26-11-8-14-6-9-24(21)10-7-14/h2-5,13-14,17,22H,6-12H2,1H3/t17-/m1/s1 |
| InChIKey | XEIUSLPSYHRXLD-QGZVFWFLSA-N |
| XLogP | 3.63 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|