C24H34N2O4 — CID 139404154
tert-butyl 4-[2-[3-(1-methylindol-3-yl)propanoyloxy]ethyl]piperidine-1-carboxylate (PubChem CID 139404154) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is tert-butyl 4-[2-[3-(1-methylindol-3-yl)propanoyloxy]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[3-(1-methylindol-3-yl)propanoyloxy]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139404154 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | tert-butyl 4-[2-[3-(1-methylindol-3-yl)propanoyloxy]ethyl]piperidine-1-carboxylate |
| SMILES | Cn1cc(CCC(=O)OCCC2CCN(C(=O)OC(C)(C)C)CC2)c2ccccc21 |
| InChI | InChI=1S/C24H34N2O4/c1-24(2,3)30-23(28)26-14-11-18(12-15-26)13-16-29-22(27)10-9-19-17-25(4)21-8-6-5-7-20(19)21/h5-8,17-18H,9-16H2,1-4H3 |
| InChIKey | YFTNIHYRKBDKHV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |