C24H33N3O4 — CID 175634613
tert-butyl (2S)-2-[[(2S)-2-(methylamino)-3-(1-methylindol-3-yl)propanoyl]amino]-5-oxohept-6-enoate (PubChem CID 175634613) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-(methylamino)-3-(1-methylindol-3-yl)propanoyl]amino]-5-oxohept-6-enoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-(methylamino)-3-(1-methylindol-3-yl)propanoyl]amino]-5-oxohept-6-enoate |
|---|---|
| PubChem CID | 175634613 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-(methylamino)-3-(1-methylindol-3-yl)propanoyl]amino]-5-oxohept-6-enoate |
| SMILES | C=CC(=O)CC[C@H](NC(=O)[C@H](Cc1cn(C)c2ccccc12)NC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H33N3O4/c1-7-17(28)12-13-19(23(30)31-24(2,3)4)26-22(29)20(25-5)14-16-15-27(6)21-11-9-8-10-18(16)21/h7-11,15,19-20,25H,1,12-14H2,2-6H3,(H,26,29)/t19-,20-/m0/s1 |
| InChIKey | AXOLBAXQYVWGCN-PMACEKPBSA-N |
| XLogP | 2.67 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|