C24H32Cl2N4O5 — CID 166105944
tert-butyl 2-[[2-[(2,2-dichloroacetyl)amino]acetyl]amino]-6-imino-5-oxohexanoate;1,3-dimethylindole (PubChem CID 166105944) has the molecular formula C24H32Cl2N4O5 and a molecular weight of 527.45 g/mol. Its IUPAC name is tert-butyl 2-[[2-[(2,2-dichloroacetyl)amino]acetyl]amino]-6-imino-5-oxohexanoate;1,3-dimethylindole.
| Compound Name | tert-butyl 2-[[2-[(2,2-dichloroacetyl)amino]acetyl]amino]-6-imino-5-oxohexanoate;1,3-dimethylindole |
|---|---|
| PubChem CID | 166105944 |
| Molecular Formula | C24H32Cl2N4O5 |
| Molecular Weight | 527.45 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | tert-butyl 2-[[2-[(2,2-dichloroacetyl)amino]acetyl]amino]-6-imino-5-oxohexanoate;1,3-dimethylindole |
| SMILES | Cc1cn(C)c2ccccc12.[H]/N=C/C(=O)CCC(NC(=O)CNC(=O)C(Cl)Cl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21Cl2N3O5.C10H11N/c1-14(2,3)24-13(23)9(5-4-8(20)6-17)19-10(21)7-18-12(22)11(15)16;1-8-7-11(2)10-6-4-3-5-9(8)10/h6,9,11,17H,4-5,7H2,1-3H3,(H,18,22)(H,19,21);3-7H,1-2H3/b17-6+; |
| InChIKey | NDJQMYQUHYEJCY-ZDEOBDHWSA-N |
| XLogP | 3.22 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|