C23H32N4O5 — CID 166106059
tert-butyl 2-[(2-acetamidoacetyl)amino]-6-imino-5-oxohexanoate;3-methyl-1H-indole (PubChem CID 166106059) has the molecular formula C23H32N4O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is tert-butyl 2-[(2-acetamidoacetyl)amino]-6-imino-5-oxohexanoate;3-methyl-1H-indole.
| Compound Name | tert-butyl 2-[(2-acetamidoacetyl)amino]-6-imino-5-oxohexanoate;3-methyl-1H-indole |
|---|---|
| PubChem CID | 166106059 |
| Molecular Formula | C23H32N4O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | tert-butyl 2-[(2-acetamidoacetyl)amino]-6-imino-5-oxohexanoate;3-methyl-1H-indole |
| SMILES | Cc1c[nH]c2ccccc12.[H]/N=C/C(=O)CCC(NC(=O)CNC(C)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23N3O5.C9H9N/c1-9(18)16-8-12(20)17-11(6-5-10(19)7-15)13(21)22-14(2,3)4;1-7-6-10-9-5-3-2-4-8(7)9/h7,11,15H,5-6,8H2,1-4H3,(H,16,18)(H,17,20);2-6,10H,1H3/b15-7+; |
| InChIKey | SSEHEMMSRJGDHN-HAZZGOGXSA-N |
| XLogP | 2.42 |
| TPSA | 141.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|