C13H21N3O5 — CID 166105899
tert-butyl 2-[(2-formamidoacetyl)amino]-6-imino-5-oxohexanoate (PubChem CID 166105899) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is tert-butyl 2-[(2-formamidoacetyl)amino]-6-imino-5-oxohexanoate.
| Compound Name | tert-butyl 2-[(2-formamidoacetyl)amino]-6-imino-5-oxohexanoate |
|---|---|
| PubChem CID | 166105899 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | tert-butyl 2-[(2-formamidoacetyl)amino]-6-imino-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CCC(NC(=O)CNC=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21N3O5/c1-13(2,3)21-12(20)10(5-4-9(18)6-14)16-11(19)7-15-8-17/h6,8,10,14H,4-5,7H2,1-3H3,(H,15,17)(H,16,19)/b14-6+ |
| InChIKey | GFRUTYWDNFSWNO-MKMNVTDBSA-N |
| XLogP | -0.44 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|