C27H43N4O9Si — CID 171550193
CID 171550193 (PubChem CID 171550193) has the molecular formula C27H43N4O9Si and a molecular weight of 595.75 g/mol.
| Compound Name | CID 171550193 |
|---|---|
| PubChem CID | 171550193 |
| Molecular Formula | C27H43N4O9Si |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | — |
| SMILES | [H]/N=C/C(=O)CC[Si](NC(=O)CC[C@H](NC(C)=O)C(=O)OC(C)(C)C)C(=O)N[C@@H](CCC(=O)C=C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H43N4O9Si/c1-9-18(33)10-11-21(24(37)40-27(6,7)8)30-25(38)41(15-14-19(34)16-28)31-22(35)13-12-20(29-17(2)32)23(36)39-26(3,4)5/h9,16,20-21,28H,1,10-15H2,2-8H3,(H,29,32)(H,30,38)(H,31,35)/b28-16+/t20-,21-/m0/s1 |
| InChIKey | ASSXAPFXAMFXSU-XTWGHZCASA-N |
| XLogP | 1.87 |
| TPSA | 197.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|