C13H19Cl2NO4 — CID 166106055
tert-butyl (2S)-2-[(2,2-dichloroacetyl)amino]-5-oxohept-6-enoate (PubChem CID 166106055) has the molecular formula C13H19Cl2NO4 and a molecular weight of 324.20 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2,2-dichloroacetyl)amino]-5-oxohept-6-enoate.
| Compound Name | tert-butyl (2S)-2-[(2,2-dichloroacetyl)amino]-5-oxohept-6-enoate |
|---|---|
| PubChem CID | 166106055 |
| Molecular Formula | C13H19Cl2NO4 |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | tert-butyl (2S)-2-[(2,2-dichloroacetyl)amino]-5-oxohept-6-enoate |
| SMILES | C=CC(=O)CC[C@H](NC(=O)C(Cl)Cl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H19Cl2NO4/c1-5-8(17)6-7-9(16-11(18)10(14)15)12(19)20-13(2,3)4/h5,9-10H,1,6-7H2,2-4H3,(H,16,18)/t9-/m0/s1 |
| InChIKey | FGVWVEJFWWUNSZ-VIFPVBQESA-N |
| XLogP | 2.15 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|