C21H38N4O5 — CID 166105973
tert-butyl (2S)-2-[[(2S)-2-[[2-(dimethylamino)acetyl]amino]-4,4-dimethylpentanoyl]amino]-6-imino-5-oxohexanoate (PubChem CID 166105973) has the molecular formula C21H38N4O5 and a molecular weight of 426.56 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-[[2-(dimethylamino)acetyl]amino]-4,4-dimethylpentanoyl]amino]-6-imino-5-oxohexanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-[[2-(dimethylamino)acetyl]amino]-4,4-dimethylpentanoyl]amino]-6-imino-5-oxohexanoate |
|---|---|
| PubChem CID | 166105973 |
| Molecular Formula | C21H38N4O5 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-[[2-(dimethylamino)acetyl]amino]-4,4-dimethylpentanoyl]amino]-6-imino-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](CC(C)(C)C)NC(=O)CN(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H38N4O5/c1-20(2,3)11-16(23-17(27)13-25(7)8)18(28)24-15(10-9-14(26)12-22)19(29)30-21(4,5)6/h12,15-16,22H,9-11,13H2,1-8H3,(H,23,27)(H,24,28)/b22-12+/t15-,16-/m0/s1 |
| InChIKey | DNBZSIPBHLSEMO-RQPWHRJUSA-N |
| XLogP | 1.29 |
| TPSA | 128.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|