C14H23N3O5 — CID 166105961
tert-butyl 2-[(2-acetamidoacetyl)amino]-6-imino-5-oxohexanoate (PubChem CID 166105961) has the molecular formula C14H23N3O5 and a molecular weight of 313.35 g/mol. Its IUPAC name is tert-butyl 2-[(2-acetamidoacetyl)amino]-6-imino-5-oxohexanoate.
| Compound Name | tert-butyl 2-[(2-acetamidoacetyl)amino]-6-imino-5-oxohexanoate |
|---|---|
| PubChem CID | 166105961 |
| Molecular Formula | C14H23N3O5 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | tert-butyl 2-[(2-acetamidoacetyl)amino]-6-imino-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CCC(NC(=O)CNC(C)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23N3O5/c1-9(18)16-8-12(20)17-11(6-5-10(19)7-15)13(21)22-14(2,3)4/h7,11,15H,5-6,8H2,1-4H3,(H,16,18)(H,17,20)/b15-7+ |
| InChIKey | KISIUICAWYWRLA-VIZOYTHASA-N |
| XLogP | -0.05 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|