C16H28N2O6 — CID 155064950
5-O-tert-butyl 1-O-propan-2-yl 2-[(2-acetamidoacetyl)amino]pentanedioate (PubChem CID 155064950) has the molecular formula C16H28N2O6 and a molecular weight of 344.41 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-propan-2-yl 2-[(2-acetamidoacetyl)amino]pentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-propan-2-yl 2-[(2-acetamidoacetyl)amino]pentanedioate |
|---|---|
| PubChem CID | 155064950 |
| Molecular Formula | C16H28N2O6 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 5-O-tert-butyl 1-O-propan-2-yl 2-[(2-acetamidoacetyl)amino]pentanedioate |
| SMILES | CC(=O)NCC(=O)NC(CCC(=O)OC(C)(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C16H28N2O6/c1-10(2)23-15(22)12(18-13(20)9-17-11(3)19)7-8-14(21)24-16(4,5)6/h10,12H,7-9H2,1-6H3,(H,17,19)(H,18,20) |
| InChIKey | DJDFTAGFKANMAW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |