C20H38N4O6 — CID 166076209
tert-butyl (2S)-2-[[2-[[2-(2-aminoethoxy)acetyl]amino]acetyl]amino]-6-imino-5-oxohexanoate;2-methylpropane (PubChem CID 166076209) has the molecular formula C20H38N4O6 and a molecular weight of 430.55 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-[[2-(2-aminoethoxy)acetyl]amino]acetyl]amino]-6-imino-5-oxohexanoate;2-methylpropane.
| Compound Name | tert-butyl (2S)-2-[[2-[[2-(2-aminoethoxy)acetyl]amino]acetyl]amino]-6-imino-5-oxohexanoate;2-methylpropane |
|---|---|
| PubChem CID | 166076209 |
| Molecular Formula | C20H38N4O6 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | tert-butyl (2S)-2-[[2-[[2-(2-aminoethoxy)acetyl]amino]acetyl]amino]-6-imino-5-oxohexanoate;2-methylpropane |
| SMILES | CC(C)C.[H]/N=C/C(=O)CC[C@H](NC(=O)CNC(=O)COCCN)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N4O6.C4H10/c1-16(2,3)26-15(24)12(5-4-11(21)8-18)20-13(22)9-19-14(23)10-25-7-6-17;1-4(2)3/h8,12,18H,4-7,9-10,17H2,1-3H3,(H,19,23)(H,20,22);4H,1-3H3/b18-8+;/t12-;/m0./s1 |
| InChIKey | HPGXLYUXSWVMKB-OFHNCMCKSA-N |
| XLogP | 0.57 |
| TPSA | 160.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|