C23H32N4O5 — CID 166106077
1,3-dimethylindole;propan-2-yl 2-[(2-acetamidoacetyl)amino]-6-imino-5-oxohexanoate (PubChem CID 166106077) has the molecular formula C23H32N4O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is 1,3-dimethylindole;propan-2-yl 2-[(2-acetamidoacetyl)amino]-6-imino-5-oxohexanoate.
| Compound Name | 1,3-dimethylindole;propan-2-yl 2-[(2-acetamidoacetyl)amino]-6-imino-5-oxohexanoate |
|---|---|
| PubChem CID | 166106077 |
| Molecular Formula | C23H32N4O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 1,3-dimethylindole;propan-2-yl 2-[(2-acetamidoacetyl)amino]-6-imino-5-oxohexanoate |
| SMILES | Cc1cn(C)c2ccccc12.[H]/N=C/C(=O)CCC(NC(=O)CNC(C)=O)C(=O)OC(C)C |
| InChI | InChI=1S/C13H21N3O5.C10H11N/c1-8(2)21-13(20)11(5-4-10(18)6-14)16-12(19)7-15-9(3)17;1-8-7-11(2)10-6-4-3-5-9(8)10/h6,8,11,14H,4-5,7H2,1-3H3,(H,15,17)(H,16,19);3-7H,1-2H3/b14-6+; |
| InChIKey | PBBKTGNGNSNUMJ-JSSTZBRYSA-N |
| XLogP | 2.04 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|