C17H21ClN4O4 — CID 167000065
(2S)-2-[(2-acetamidoacetyl)amino]-N-[(4-chlorophenyl)methyl]-6-imino-5-oxohexanamide (PubChem CID 167000065) has the molecular formula C17H21ClN4O4 and a molecular weight of 380.83 g/mol. Its IUPAC name is (2S)-2-[(2-acetamidoacetyl)amino]-N-[(4-chlorophenyl)methyl]-6-imino-5-oxohexanamide.
| Compound Name | (2S)-2-[(2-acetamidoacetyl)amino]-N-[(4-chlorophenyl)methyl]-6-imino-5-oxohexanamide |
|---|---|
| PubChem CID | 167000065 |
| Molecular Formula | C17H21ClN4O4 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (2S)-2-[(2-acetamidoacetyl)amino]-N-[(4-chlorophenyl)methyl]-6-imino-5-oxohexanamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)CNC(C)=O)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN4O4/c1-11(23)20-10-16(25)22-15(7-6-14(24)8-19)17(26)21-9-12-2-4-13(18)5-3-12/h2-5,8,15,19H,6-7,9-10H2,1H3,(H,20,23)(H,21,26)(H,22,25)/b19-8+/t15-/m0/s1 |
| InChIKey | ZRQFJFFWJOGPQR-UZSVJVCZSA-N |
| XLogP | 0.58 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|