C19H24FN5O5 — CID 167000058
(2S)-2-acetamido-N-[(2S)-1-[(4-fluorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]butanediamide (PubChem CID 167000058) has the molecular formula C19H24FN5O5 and a molecular weight of 421.43 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[(2S)-1-[(4-fluorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]butanediamide.
| Compound Name | (2S)-2-acetamido-N-[(2S)-1-[(4-fluorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]butanediamide |
|---|---|
| PubChem CID | 167000058 |
| Molecular Formula | C19H24FN5O5 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | (2S)-2-acetamido-N-[(2S)-1-[(4-fluorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]butanediamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](CC(N)=O)NC(C)=O)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H24FN5O5/c1-11(26)24-16(8-17(22)28)19(30)25-15(7-6-14(27)9-21)18(29)23-10-12-2-4-13(20)5-3-12/h2-5,9,15-16,21H,6-8,10H2,1H3,(H2,22,28)(H,23,29)(H,24,26)(H,25,30)/b21-9+/t15-,16-/m0/s1 |
| InChIKey | ZMBSMFGRQZEDQB-PDTULXRVSA-N |
| XLogP | -0.69 |
| TPSA | 171.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|