C20H25FN4O4 — CID 167001056
(2S)-1-acetyl-N-[(2S)-1-[(4-fluorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 167001056) has the molecular formula C20H25FN4O4 and a molecular weight of 404.44 g/mol. Its IUPAC name is (2S)-1-acetyl-N-[(2S)-1-[(4-fluorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-acetyl-N-[(2S)-1-[(4-fluorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 167001056 |
| Molecular Formula | C20H25FN4O4 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (2S)-1-acetyl-N-[(2S)-1-[(4-fluorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@@H]1CCCN1C(C)=O)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H25FN4O4/c1-13(26)25-10-2-3-18(25)20(29)24-17(9-8-16(27)11-22)19(28)23-12-14-4-6-15(21)7-5-14/h4-7,11,17-18,22H,2-3,8-10,12H2,1H3,(H,23,28)(H,24,29)/b22-11+/t17-,18-/m0/s1 |
| InChIKey | FRUPYZILAITGLN-AIHKSIKWSA-N |
| XLogP | 0.94 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|