C19H25ClN4O3 — CID 167001137
1-amino-N-[(2S)-1-[(4-chlorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]cyclopentane-1-carboxamide (PubChem CID 167001137) has the molecular formula C19H25ClN4O3 and a molecular weight of 392.89 g/mol. Its IUPAC name is 1-amino-N-[(2S)-1-[(4-chlorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]cyclopentane-1-carboxamide.
| Compound Name | 1-amino-N-[(2S)-1-[(4-chlorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 167001137 |
| Molecular Formula | C19H25ClN4O3 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-amino-N-[(2S)-1-[(4-chlorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]cyclopentane-1-carboxamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)C1(N)CCCC1)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H25ClN4O3/c20-14-5-3-13(4-6-14)12-23-17(26)16(8-7-15(25)11-21)24-18(27)19(22)9-1-2-10-19/h3-6,11,16,21H,1-2,7-10,12,22H2,(H,23,26)(H,24,27)/b21-11+/t16-/m0/s1 |
| InChIKey | OTBJNAJEJUTYAG-XYHOIZSOSA-N |
| XLogP | 1.71 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|