C21H28N4O5 — CID 167000282
(2S)-2-[[(2S)-2-acetamido-2-cyclopropylacetyl]amino]-6-imino-N-[(4-methoxyphenyl)methyl]-5-oxohexanamide (PubChem CID 167000282) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamido-2-cyclopropylacetyl]amino]-6-imino-N-[(4-methoxyphenyl)methyl]-5-oxohexanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamido-2-cyclopropylacetyl]amino]-6-imino-N-[(4-methoxyphenyl)methyl]-5-oxohexanamide |
|---|---|
| PubChem CID | 167000282 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-2-cyclopropylacetyl]amino]-6-imino-N-[(4-methoxyphenyl)methyl]-5-oxohexanamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@@H](NC(C)=O)C1CC1)C(=O)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H28N4O5/c1-13(26)24-19(15-5-6-15)21(29)25-18(10-7-16(27)11-22)20(28)23-12-14-3-8-17(30-2)9-4-14/h3-4,8-9,11,15,18-19,22H,5-7,10,12H2,1-2H3,(H,23,28)(H,24,26)(H,25,29)/b22-11+/t18-,19-/m0/s1 |
| InChIKey | NFCSJOCHTIJLQB-RCTBGBINSA-N |
| XLogP | 0.71 |
| TPSA | 137.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|