C20H26N4O4 — CID 167000283
(2S)-2-[[(2S)-2-acetamido-2-cyclopropylacetyl]amino]-N-benzyl-6-imino-5-oxohexanamide (PubChem CID 167000283) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamido-2-cyclopropylacetyl]amino]-N-benzyl-6-imino-5-oxohexanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamido-2-cyclopropylacetyl]amino]-N-benzyl-6-imino-5-oxohexanamide |
|---|---|
| PubChem CID | 167000283 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-2-cyclopropylacetyl]amino]-N-benzyl-6-imino-5-oxohexanamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@@H](NC(C)=O)C1CC1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H26N4O4/c1-13(25)23-18(15-7-8-15)20(28)24-17(10-9-16(26)11-21)19(27)22-12-14-5-3-2-4-6-14/h2-6,11,15,17-18,21H,7-10,12H2,1H3,(H,22,27)(H,23,25)(H,24,28)/b21-11+/t17-,18-/m0/s1 |
| InChIKey | FESJFORKYNMPJW-IRPSRWQTSA-N |
| XLogP | 0.70 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|