C20H25FN4O6 — CID 167000598
(4S)-4-acetamido-5-[[(2S)-1-[(4-fluorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 167000598) has the molecular formula C20H25FN4O6 and a molecular weight of 436.44 g/mol. Its IUPAC name is (4S)-4-acetamido-5-[[(2S)-1-[(4-fluorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-acetamido-5-[[(2S)-1-[(4-fluorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 167000598 |
| Molecular Formula | C20H25FN4O6 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | (4S)-4-acetamido-5-[[(2S)-1-[(4-fluorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](CCC(=O)O)NC(C)=O)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H25FN4O6/c1-12(26)24-17(8-9-18(28)29)20(31)25-16(7-6-15(27)10-22)19(30)23-11-13-2-4-14(21)5-3-13/h2-5,10,16-17,22H,6-9,11H2,1H3,(H,23,30)(H,24,26)(H,25,31)(H,28,29)/b22-10+/t16-,17-/m0/s1 |
| InChIKey | NRDLTMUFJFCLFD-UIPCJRQQSA-N |
| XLogP | 0.30 |
| TPSA | 165.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|