C23H33FN4O4 — CID 167000044
(2S)-N-[(4-fluorophenyl)methyl]-6-imino-2-[[(2S)-4-methyl-2-(2-methylpropanoylamino)pentanoyl]amino]-5-oxohexanamide (PubChem CID 167000044) has the molecular formula C23H33FN4O4 and a molecular weight of 448.54 g/mol. Its IUPAC name is (2S)-N-[(4-fluorophenyl)methyl]-6-imino-2-[[(2S)-4-methyl-2-(2-methylpropanoylamino)pentanoyl]amino]-5-oxohexanamide.
| Compound Name | (2S)-N-[(4-fluorophenyl)methyl]-6-imino-2-[[(2S)-4-methyl-2-(2-methylpropanoylamino)pentanoyl]amino]-5-oxohexanamide |
|---|---|
| PubChem CID | 167000044 |
| Molecular Formula | C23H33FN4O4 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | (2S)-N-[(4-fluorophenyl)methyl]-6-imino-2-[[(2S)-4-methyl-2-(2-methylpropanoylamino)pentanoyl]amino]-5-oxohexanamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)C(C)C)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H33FN4O4/c1-14(2)11-20(28-21(30)15(3)4)23(32)27-19(10-9-18(29)12-25)22(31)26-13-16-5-7-17(24)8-6-16/h5-8,12,14-15,19-20,25H,9-11,13H2,1-4H3,(H,26,31)(H,27,32)(H,28,30)/b25-12+/t19-,20-/m0/s1 |
| InChIKey | YQGATBIVBMSIHU-YRPMSYFPSA-N |
| XLogP | 2.11 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|