C22H31FN4O4 — CID 167000546
(2S)-N-[(4-fluorophenyl)methyl]-6-imino-2-[[(2S)-3-methyl-2-(propanoylamino)pentanoyl]amino]-5-oxohexanamide (PubChem CID 167000546) has the molecular formula C22H31FN4O4 and a molecular weight of 434.51 g/mol. Its IUPAC name is (2S)-N-[(4-fluorophenyl)methyl]-6-imino-2-[[(2S)-3-methyl-2-(propanoylamino)pentanoyl]amino]-5-oxohexanamide.
| Compound Name | (2S)-N-[(4-fluorophenyl)methyl]-6-imino-2-[[(2S)-3-methyl-2-(propanoylamino)pentanoyl]amino]-5-oxohexanamide |
|---|---|
| PubChem CID | 167000546 |
| Molecular Formula | C22H31FN4O4 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (2S)-N-[(4-fluorophenyl)methyl]-6-imino-2-[[(2S)-3-methyl-2-(propanoylamino)pentanoyl]amino]-5-oxohexanamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@@H](NC(=O)CC)C(C)CC)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H31FN4O4/c1-4-14(3)20(27-19(29)5-2)22(31)26-18(11-10-17(28)12-24)21(30)25-13-15-6-8-16(23)9-7-15/h6-9,12,14,18,20,24H,4-5,10-11,13H2,1-3H3,(H,25,30)(H,26,31)(H,27,29)/b24-12+/t14?,18-,20-/m0/s1 |
| InChIKey | PFUKAIAKMBAJDR-APADSKLNSA-N |
| XLogP | 1.87 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|