C19H25FN4O4 — CID 167000069
(2S)-N-[(4-fluorophenyl)methyl]-6-imino-2-[[2-(2-methylpropanoylamino)acetyl]amino]-5-oxohexanamide (PubChem CID 167000069) has the molecular formula C19H25FN4O4 and a molecular weight of 392.43 g/mol. Its IUPAC name is (2S)-N-[(4-fluorophenyl)methyl]-6-imino-2-[[2-(2-methylpropanoylamino)acetyl]amino]-5-oxohexanamide.
| Compound Name | (2S)-N-[(4-fluorophenyl)methyl]-6-imino-2-[[2-(2-methylpropanoylamino)acetyl]amino]-5-oxohexanamide |
|---|---|
| PubChem CID | 167000069 |
| Molecular Formula | C19H25FN4O4 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | (2S)-N-[(4-fluorophenyl)methyl]-6-imino-2-[[2-(2-methylpropanoylamino)acetyl]amino]-5-oxohexanamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)CNC(=O)C(C)C)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H25FN4O4/c1-12(2)18(27)23-11-17(26)24-16(8-7-15(25)9-21)19(28)22-10-13-3-5-14(20)6-4-13/h3-6,9,12,16,21H,7-8,10-11H2,1-2H3,(H,22,28)(H,23,27)(H,24,26)/b21-9+/t16-/m0/s1 |
| InChIKey | YYPIZZREWGQRRN-BCUFPXHISA-N |
| XLogP | 0.70 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|