C21H29ClN4O4 — CID 167001123
(2S)-2-[(2-acetamido-2-ethylbutanoyl)amino]-N-[(4-chlorophenyl)methyl]-6-imino-5-oxohexanamide (PubChem CID 167001123) has the molecular formula C21H29ClN4O4 and a molecular weight of 436.94 g/mol. Its IUPAC name is (2S)-2-[(2-acetamido-2-ethylbutanoyl)amino]-N-[(4-chlorophenyl)methyl]-6-imino-5-oxohexanamide.
| Compound Name | (2S)-2-[(2-acetamido-2-ethylbutanoyl)amino]-N-[(4-chlorophenyl)methyl]-6-imino-5-oxohexanamide |
|---|---|
| PubChem CID | 167001123 |
| Molecular Formula | C21H29ClN4O4 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (2S)-2-[(2-acetamido-2-ethylbutanoyl)amino]-N-[(4-chlorophenyl)methyl]-6-imino-5-oxohexanamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)C(CC)(CC)NC(C)=O)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H29ClN4O4/c1-4-21(5-2,26-14(3)27)20(30)25-18(11-10-17(28)12-23)19(29)24-13-15-6-8-16(22)9-7-15/h6-9,12,18,23H,4-5,10-11,13H2,1-3H3,(H,24,29)(H,25,30)(H,26,27)/b23-12+/t18-/m0/s1 |
| InChIKey | OLLRANBSKSYCSS-KCDOPAPYSA-N |
| XLogP | 2.13 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|