C23H31ClN4O4 — CID 167001122
(2S)-2-[[(2S)-2-acetamido-3-cyclopentylpropanoyl]amino]-N-[(4-chlorophenyl)methyl]-6-imino-5-oxohexanamide (PubChem CID 167001122) has the molecular formula C23H31ClN4O4 and a molecular weight of 462.98 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamido-3-cyclopentylpropanoyl]amino]-N-[(4-chlorophenyl)methyl]-6-imino-5-oxohexanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamido-3-cyclopentylpropanoyl]amino]-N-[(4-chlorophenyl)methyl]-6-imino-5-oxohexanamide |
|---|---|
| PubChem CID | 167001122 |
| Molecular Formula | C23H31ClN4O4 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-3-cyclopentylpropanoyl]amino]-N-[(4-chlorophenyl)methyl]-6-imino-5-oxohexanamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](CC1CCCC1)NC(C)=O)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H31ClN4O4/c1-15(29)27-21(12-16-4-2-3-5-16)23(32)28-20(11-10-19(30)13-25)22(31)26-14-17-6-8-18(24)9-7-17/h6-9,13,16,20-21,25H,2-5,10-12,14H2,1H3,(H,26,31)(H,27,29)(H,28,32)/b25-13+/t20-,21-/m0/s1 |
| InChIKey | MUSTYVSZBZBDPO-JZEGZXMSSA-N |
| XLogP | 2.52 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|