C24H28N4O4 — CID 167000292
(2S)-2-[[(2S)-2-acetamido-2-phenylacetyl]amino]-6-imino-N-[(4-methylphenyl)methyl]-5-oxohexanamide (PubChem CID 167000292) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamido-2-phenylacetyl]amino]-6-imino-N-[(4-methylphenyl)methyl]-5-oxohexanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamido-2-phenylacetyl]amino]-6-imino-N-[(4-methylphenyl)methyl]-5-oxohexanamide |
|---|---|
| PubChem CID | 167000292 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-2-phenylacetyl]amino]-6-imino-N-[(4-methylphenyl)methyl]-5-oxohexanamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@@H](NC(C)=O)c1ccccc1)C(=O)NCc1ccc(C)cc1 |
| InChI | InChI=1S/C24H28N4O4/c1-16-8-10-18(11-9-16)15-26-23(31)21(13-12-20(30)14-25)28-24(32)22(27-17(2)29)19-6-4-3-5-7-19/h3-11,14,21-22,25H,12-13,15H2,1-2H3,(H,26,31)(H,27,29)(H,28,32)/b25-14+/t21-,22-/m0/s1 |
| InChIKey | ZISGOVQMBHSRGP-WXHUKZBHSA-N |
| XLogP | 1.97 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|