C18H23FN4O4S — CID 167000910
(2S)-2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]-N-[(4-fluorophenyl)methyl]-6-imino-5-oxohexanamide (PubChem CID 167000910) has the molecular formula C18H23FN4O4S and a molecular weight of 410.47 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]-N-[(4-fluorophenyl)methyl]-6-imino-5-oxohexanamide.
| Compound Name | (2S)-2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]-N-[(4-fluorophenyl)methyl]-6-imino-5-oxohexanamide |
|---|---|
| PubChem CID | 167000910 |
| Molecular Formula | C18H23FN4O4S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (2S)-2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]-N-[(4-fluorophenyl)methyl]-6-imino-5-oxohexanamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](CS)NC(C)=O)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H23FN4O4S/c1-11(24)22-16(10-28)18(27)23-15(7-6-14(25)8-20)17(26)21-9-12-2-4-13(19)5-3-12/h2-5,8,15-16,20,28H,6-7,9-10H2,1H3,(H,21,26)(H,22,24)(H,23,27)/b20-8+/t15-,16-/m0/s1 |
| InChIKey | VUBMHDBDERWNMG-JRSVZZNJSA-N |
| XLogP | 0.36 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|