C21H25N5O4S — CID 167000778
(2S)-2-[[(2S)-2-acetamido-3-(1,3-thiazol-4-yl)propanoyl]amino]-N-benzyl-6-imino-5-oxohexanamide (PubChem CID 167000778) has the molecular formula C21H25N5O4S and a molecular weight of 443.53 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamido-3-(1,3-thiazol-4-yl)propanoyl]amino]-N-benzyl-6-imino-5-oxohexanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamido-3-(1,3-thiazol-4-yl)propanoyl]amino]-N-benzyl-6-imino-5-oxohexanamide |
|---|---|
| PubChem CID | 167000778 |
| Molecular Formula | C21H25N5O4S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-3-(1,3-thiazol-4-yl)propanoyl]amino]-N-benzyl-6-imino-5-oxohexanamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](Cc1cscn1)NC(C)=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H25N5O4S/c1-14(27)25-19(9-16-12-31-13-24-16)21(30)26-18(8-7-17(28)10-22)20(29)23-11-15-5-3-2-4-6-15/h2-6,10,12-13,18-19,22H,7-9,11H2,1H3,(H,23,29)(H,25,27)(H,26,30)/b22-10+/t18-,19-/m0/s1 |
| InChIKey | LSQHOKWQSXGISF-GONAZFFLSA-N |
| XLogP | 0.99 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|