2-acetamido-3-(1,3-thiazol-4-yl)propanoic acid

C8H10N2O3S — CID 15018091

IUPAC2-acetamido-3-(1,3-thiazol-4-yl)propanoic acid
SMILESCC(=O)NC(Cc1cscn1)C(=O)O
InChIInChI=1S/C8H10N2O3S/c1-5(11)10-7(8(12)13)2-6-3-14-4-9-6/h3-4,7H,2H2,1H3,(H,10,11)(H,12,13)
InChIKeyILHYKYSUZWFTFP-UHFFFAOYSA-N
MW214.25 g/mol
LogP0.27
Rot. Bonds4

About 2-acetamido-3-(1,3-thiazol-4-yl)propanoic acid

2-acetamido-3-(1,3-thiazol-4-yl)propanoic acid (PubChem CID 15018091) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is 2-acetamido-3-(1,3-thiazol-4-yl)propanoic acid.

Molecular Properties

Compound Name2-acetamido-3-(1,3-thiazol-4-yl)propanoic acid
PubChem CID15018091
Molecular FormulaC8H10N2O3S
Molecular Weight214.25 g/mol
Exact Mass214.04
IUPAC Name2-acetamido-3-(1,3-thiazol-4-yl)propanoic acid
SMILESCC(=O)NC(Cc1cscn1)C(=O)O
InChIInChI=1S/C8H10N2O3S/c1-5(11)10-7(8(12)13)2-6-3-14-4-9-6/h3-4,7H,2H2,1H3,(H,10,11)(H,12,13)
InChIKeyILHYKYSUZWFTFP-UHFFFAOYSA-N
XLogP0.27
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.25
LogP ≤ 50.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-acetamido-3-(1,3-thiazol-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetamido-3-(1,3-thiazol-4-yl)propanoic acid?
The IUPAC name of 2-acetamido-3-(1,3-thiazol-4-yl)propanoic acid (CID 15018091) is 2-acetamido-3-(1,3-thiazol-4-yl)propanoic acid.
What is the SMILES notation for 2-acetamido-3-(1,3-thiazol-4-yl)propanoic acid?
The canonical SMILES for 2-acetamido-3-(1,3-thiazol-4-yl)propanoic acid is CC(=O)NC(Cc1cscn1)C(=O)O.
What is the InChIKey of 2-acetamido-3-(1,3-thiazol-4-yl)propanoic acid?
The InChIKey is ILHYKYSUZWFTFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3S/c1-5(11)10-7(8(12)13)2-6-3-14-4-9-6/h3-4,7H,2H2,1H3,(H,10,11)(H,12,13).
What are the key properties of 2-acetamido-3-(1,3-thiazol-4-yl)propanoic acid?
2-acetamido-3-(1,3-thiazol-4-yl)propanoic acid has a molecular weight of 214.25 g/mol, XLogP of 0.27, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-3-(1,3-thiazol-4-yl)propanoic acid is sourced from PubChem (CID 15018091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).