2-amino-3-hydroxypropanoic acid;2-amino-3-(1,3-thiazol-4-yl)propanoic acid

C9H15N3O5S — CID 68809495

IUPAC2-amino-3-hydroxypropanoic acid;2-amino-3-(1,3-thiazol-4-yl)propanoic acid
SMILESNC(CO)C(=O)O.NC(Cc1cscn1)C(=O)O
InChIInChI=1S/C6H8N2O2S.C3H7NO3/c7-5(6(9)10)1-4-2-11-3-8-4;4-2(1-5)3(6)7/h2-3,5H,1,7H2,(H,9,10);2,5H,1,4H2,(H,6,7)
InChIKeyAMUKSUNHTIICJE-UHFFFAOYSA-N
MW277.30 g/mol
LogP-1.51
Rot. Bonds5

About 2-amino-3-hydroxypropanoic acid;2-amino-3-(1,3-thiazol-4-yl)propanoic acid

2-amino-3-hydroxypropanoic acid;2-amino-3-(1,3-thiazol-4-yl)propanoic acid (PubChem CID 68809495) has the molecular formula C9H15N3O5S and a molecular weight of 277.30 g/mol. Its IUPAC name is 2-amino-3-hydroxypropanoic acid;2-amino-3-(1,3-thiazol-4-yl)propanoic acid.

Molecular Properties

Compound Name2-amino-3-hydroxypropanoic acid;2-amino-3-(1,3-thiazol-4-yl)propanoic acid
PubChem CID68809495
Molecular FormulaC9H15N3O5S
Molecular Weight277.30 g/mol
Exact Mass277.07
IUPAC Name2-amino-3-hydroxypropanoic acid;2-amino-3-(1,3-thiazol-4-yl)propanoic acid
SMILESNC(CO)C(=O)O.NC(Cc1cscn1)C(=O)O
InChIInChI=1S/C6H8N2O2S.C3H7NO3/c7-5(6(9)10)1-4-2-11-3-8-4;4-2(1-5)3(6)7/h2-3,5H,1,7H2,(H,9,10);2,5H,1,4H2,(H,6,7)
InChIKeyAMUKSUNHTIICJE-UHFFFAOYSA-N
XLogP-1.51
TPSA159.76 Ų
H-Bond Donors5
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.30
LogP ≤ 5-1.51
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 107

Analyze 2-amino-3-hydroxypropanoic acid;2-amino-3-(1,3-thiazol-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-hydroxypropanoic acid;2-amino-3-(1,3-thiazol-4-yl)propanoic acid?
The IUPAC name of 2-amino-3-hydroxypropanoic acid;2-amino-3-(1,3-thiazol-4-yl)propanoic acid (CID 68809495) is 2-amino-3-hydroxypropanoic acid;2-amino-3-(1,3-thiazol-4-yl)propanoic acid.
What is the SMILES notation for 2-amino-3-hydroxypropanoic acid;2-amino-3-(1,3-thiazol-4-yl)propanoic acid?
The canonical SMILES for 2-amino-3-hydroxypropanoic acid;2-amino-3-(1,3-thiazol-4-yl)propanoic acid is NC(CO)C(=O)O.NC(Cc1cscn1)C(=O)O.
What is the InChIKey of 2-amino-3-hydroxypropanoic acid;2-amino-3-(1,3-thiazol-4-yl)propanoic acid?
The InChIKey is AMUKSUNHTIICJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S.C3H7NO3/c7-5(6(9)10)1-4-2-11-3-8-4;4-2(1-5)3(6)7/h2-3,5H,1,7H2,(H,9,10);2,5H,1,4H2,(H,6,7).
What are the key properties of 2-amino-3-hydroxypropanoic acid;2-amino-3-(1,3-thiazol-4-yl)propanoic acid?
2-amino-3-hydroxypropanoic acid;2-amino-3-(1,3-thiazol-4-yl)propanoic acid has a molecular weight of 277.30 g/mol, XLogP of -1.51, 5 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-hydroxypropanoic acid;2-amino-3-(1,3-thiazol-4-yl)propanoic acid is sourced from PubChem (CID 68809495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).