C27H25N3O3 — CID 98008916
(2R)-2-acetamido-3-(1-tritylimidazol-4-yl)propanoic acid (PubChem CID 98008916) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(1-tritylimidazol-4-yl)propanoic acid.
| Compound Name | (2R)-2-acetamido-3-(1-tritylimidazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 98008916 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | (2R)-2-acetamido-3-(1-tritylimidazol-4-yl)propanoic acid |
| SMILES | CC(=O)N[C@H](Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)C(=O)O |
| InChI | InChI=1S/C27H25N3O3/c1-20(31)29-25(26(32)33)17-24-18-30(19-28-24)27(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-16,18-19,25H,17H2,1H3,(H,29,31)(H,32,33)/t25-/m1/s1 |
| InChIKey | MFOVFDBMJIPSLM-RUZDIDTESA-N |
| XLogP | 3.86 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|