C30H33N3O2 — CID 142630558
methyl (2S)-2-(butylamino)-3-(1-tritylimidazol-4-yl)propanoate (PubChem CID 142630558) has the molecular formula C30H33N3O2 and a molecular weight of 467.61 g/mol. Its IUPAC name is methyl (2S)-2-(butylamino)-3-(1-tritylimidazol-4-yl)propanoate.
| Compound Name | methyl (2S)-2-(butylamino)-3-(1-tritylimidazol-4-yl)propanoate |
|---|---|
| PubChem CID | 142630558 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | methyl (2S)-2-(butylamino)-3-(1-tritylimidazol-4-yl)propanoate |
| SMILES | CCCCN[C@@H](Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)C(=O)OC |
| InChI | InChI=1S/C30H33N3O2/c1-3-4-20-31-28(29(34)35-2)21-27-22-33(23-32-27)30(24-14-8-5-9-15-24,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-19,22-23,28,31H,3-4,20-21H2,1-2H3/t28-/m0/s1 |
| InChIKey | VPNLANSSICNGCF-NDEPHWFRSA-N |
| XLogP | 5.20 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|