C35H37N5O3S — CID 59721414
methyl (2S)-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-5-yl)methyl]carbamoyl]amino]-3-(1-tritylimidazol-4-yl)propanoate (PubChem CID 59721414) has the molecular formula C35H37N5O3S and a molecular weight of 607.78 g/mol. Its IUPAC name is methyl (2S)-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-5-yl)methyl]carbamoyl]amino]-3-(1-tritylimidazol-4-yl)propanoate.
| Compound Name | methyl (2S)-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-5-yl)methyl]carbamoyl]amino]-3-(1-tritylimidazol-4-yl)propanoate |
|---|---|
| PubChem CID | 59721414 |
| Molecular Formula | C35H37N5O3S |
| Molecular Weight | 607.78 g/mol |
| Exact Mass | 607.26 |
| IUPAC Name | methyl (2S)-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-5-yl)methyl]carbamoyl]amino]-3-(1-tritylimidazol-4-yl)propanoate |
| SMILES | COC(=O)[C@H](Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)NC(=O)N(C)Cc1cnc(C(C)C)s1 |
| InChI | InChI=1S/C35H37N5O3S/c1-25(2)32-36-21-30(44-32)23-39(3)34(42)38-31(33(41)43-4)20-29-22-40(24-37-29)35(26-14-8-5-9-15-26,27-16-10-6-11-17-27)28-18-12-7-13-19-28/h5-19,21-22,24-25,31H,20,23H2,1-4H3,(H,38,42)/t31-/m0/s1 |
| InChIKey | PYJYPMDZJVNVBP-HKBQPEDESA-N |
| XLogP | 6.23 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.78 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|