C26H25N3O2 — CID 71173435
(2S)-2-(methylamino)-3-(1-tritylimidazol-4-yl)propanoic acid (PubChem CID 71173435) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is (2S)-2-(methylamino)-3-(1-tritylimidazol-4-yl)propanoic acid.
| Compound Name | (2S)-2-(methylamino)-3-(1-tritylimidazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 71173435 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (2S)-2-(methylamino)-3-(1-tritylimidazol-4-yl)propanoic acid |
| SMILES | CN[C@@H](Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)C(=O)O |
| InChI | InChI=1S/C26H25N3O2/c1-27-24(25(30)31)17-23-18-29(19-28-23)26(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,18-19,24,27H,17H2,1H3,(H,30,31)/t24-/m0/s1 |
| InChIKey | RIKRXHMBSYRLIX-DEOSSOPVSA-N |
| XLogP | 3.94 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|