C43H40N4O5 — CID 139912764
(4S)-3-oxo-2-[[(1S)-1-phenylethyl]amino]-4-(phenylmethoxycarbonylamino)-5-(1-tritylimidazol-4-yl)pentanoic acid (PubChem CID 139912764) has the molecular formula C43H40N4O5 and a molecular weight of 692.82 g/mol. Its IUPAC name is (4S)-3-oxo-2-[[(1S)-1-phenylethyl]amino]-4-(phenylmethoxycarbonylamino)-5-(1-tritylimidazol-4-yl)pentanoic acid.
| Compound Name | (4S)-3-oxo-2-[[(1S)-1-phenylethyl]amino]-4-(phenylmethoxycarbonylamino)-5-(1-tritylimidazol-4-yl)pentanoic acid |
|---|---|
| PubChem CID | 139912764 |
| Molecular Formula | C43H40N4O5 |
| Molecular Weight | 692.82 g/mol |
| Exact Mass | 692.30 |
| IUPAC Name | (4S)-3-oxo-2-[[(1S)-1-phenylethyl]amino]-4-(phenylmethoxycarbonylamino)-5-(1-tritylimidazol-4-yl)pentanoic acid |
| SMILES | C[C@H](NC(C(=O)O)C(=O)[C@H](Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)NC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H40N4O5/c1-31(33-19-9-3-10-20-33)45-39(41(49)50)40(48)38(46-42(51)52-29-32-17-7-2-8-18-32)27-37-28-47(30-44-37)43(34-21-11-4-12-22-34,35-23-13-5-14-24-35)36-25-15-6-16-26-36/h2-26,28,30-31,38-39,45H,27,29H2,1H3,(H,46,51)(H,49,50)/t31-,38-,39?/m0/s1 |
| InChIKey | AKIKPXXDTIDZES-UMGODYLESA-N |
| XLogP | 6.93 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.82 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|