C21H28N4O4 — CID 167000800
1-acetamido-N-[(2S)-1-(benzylamino)-6-imino-1,5-dioxohexan-2-yl]cyclopentane-1-carboxamide (PubChem CID 167000800) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-acetamido-N-[(2S)-1-(benzylamino)-6-imino-1,5-dioxohexan-2-yl]cyclopentane-1-carboxamide.
| Compound Name | 1-acetamido-N-[(2S)-1-(benzylamino)-6-imino-1,5-dioxohexan-2-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 167000800 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 1-acetamido-N-[(2S)-1-(benzylamino)-6-imino-1,5-dioxohexan-2-yl]cyclopentane-1-carboxamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)C1(NC(C)=O)CCCC1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H28N4O4/c1-15(26)25-21(11-5-6-12-21)20(29)24-18(10-9-17(27)13-22)19(28)23-14-16-7-3-2-4-8-16/h2-4,7-8,13,18,22H,5-6,9-12,14H2,1H3,(H,23,28)(H,24,29)(H,25,26)/b22-13+/t18-/m0/s1 |
| InChIKey | JKTGFAIEJMAQAN-ZFJBLLOBSA-N |
| XLogP | 1.24 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|