C25H27ClN4O4 — CID 167000915
2-acetamido-N-[(2S)-1-[(4-chlorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]-1,3-dihydroindene-2-carboxamide (PubChem CID 167000915) has the molecular formula C25H27ClN4O4 and a molecular weight of 482.97 g/mol. Its IUPAC name is 2-acetamido-N-[(2S)-1-[(4-chlorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]-1,3-dihydroindene-2-carboxamide.
| Compound Name | 2-acetamido-N-[(2S)-1-[(4-chlorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]-1,3-dihydroindene-2-carboxamide |
|---|---|
| PubChem CID | 167000915 |
| Molecular Formula | C25H27ClN4O4 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 2-acetamido-N-[(2S)-1-[(4-chlorophenyl)methylamino]-6-imino-1,5-dioxohexan-2-yl]-1,3-dihydroindene-2-carboxamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)C1(NC(C)=O)Cc2ccccc2C1)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H27ClN4O4/c1-16(31)30-25(12-18-4-2-3-5-19(18)13-25)24(34)29-22(11-10-21(32)14-27)23(33)28-15-17-6-8-20(26)9-7-17/h2-9,14,22,27H,10-13,15H2,1H3,(H,28,33)(H,29,34)(H,30,31)/b27-14+/t22-/m0/s1 |
| InChIKey | JNJLWMWSGQGQQB-VATWTLTGSA-N |
| XLogP | 2.11 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|