C15H23N3O4 — CID 167001038
(2S)-1-acetyl-N-[(3S)-7-imino-2,6-dioxoheptan-3-yl]piperidine-2-carboxamide (PubChem CID 167001038) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is (2S)-1-acetyl-N-[(3S)-7-imino-2,6-dioxoheptan-3-yl]piperidine-2-carboxamide.
| Compound Name | (2S)-1-acetyl-N-[(3S)-7-imino-2,6-dioxoheptan-3-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 167001038 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (2S)-1-acetyl-N-[(3S)-7-imino-2,6-dioxoheptan-3-yl]piperidine-2-carboxamide |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@@H]1CCCCN1C(C)=O)C(C)=O |
| InChI | InChI=1S/C15H23N3O4/c1-10(19)13(7-6-12(21)9-16)17-15(22)14-5-3-4-8-18(14)11(2)20/h9,13-14,16H,3-8H2,1-2H3,(H,17,22)/b16-9+/t13-,14-/m0/s1 |
| InChIKey | IMRPYQVKAUGMPU-PKDFBKMWSA-N |
| XLogP | 0.46 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|