C16H26N2O4 — CID 143354832
(2S)-1-acetyl-N-(6-methyl-2,3-dioxooctan-4-yl)pyrrolidine-2-carboxamide (PubChem CID 143354832) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is (2S)-1-acetyl-N-(6-methyl-2,3-dioxooctan-4-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-acetyl-N-(6-methyl-2,3-dioxooctan-4-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143354832 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (2S)-1-acetyl-N-(6-methyl-2,3-dioxooctan-4-yl)pyrrolidine-2-carboxamide |
| SMILES | CCC(C)CC(NC(=O)[C@@H]1CCCN1C(C)=O)C(=O)C(C)=O |
| InChI | InChI=1S/C16H26N2O4/c1-5-10(2)9-13(15(21)11(3)19)17-16(22)14-7-6-8-18(14)12(4)20/h10,13-14H,5-9H2,1-4H3,(H,17,22)/t10?,13?,14-/m0/s1 |
| InChIKey | JCARAOZNEAAFGW-DBRPNBKGSA-N |
| XLogP | 1.08 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|